EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21F2NO3 |
| Net Charge | 0 |
| Average Mass | 421.443 |
| Monoisotopic Mass | 421.14895 |
| SMILES | O=C1[C@H](C/C=C(\CO)c2ccc(F)cc2)[C@@H](c2ccc(O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C25H21F2NO3/c26-19-6-1-16(2-7-19)18(15-29)5-14-23-24(17-3-12-22(30)13-4-17)28(25(23)31)21-10-8-20(27)9-11-21/h1-13,23-24,29-30H,14-15H2/b18-5+/t23-,24-/m1/s1 |
| InChIKey | HEHHPZYUXSFAPV-SMOXZEHUSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hyzetimibe (CHEBI:756880) is a monobactam (CHEBI:50695) |
| Synonyms | Source |
|---|---|
| HS-25 | ChEMBL |
| Hybutimibe | ChEMBL |
| Hyzetimibe | ChEMBL |