EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30ClFN2O |
| Net Charge | 0 |
| Average Mass | 453.001 |
| Monoisotopic Mass | 452.20307 |
| SMILES | C[C@@H](c1cc(Cl)cc2ccccc12)N(C)C(=O)CC1(c2ccc(F)cc2)CCN(C)CC1 |
| InChI | InChI=1S/C27H30ClFN2O/c1-19(25-17-22(28)16-20-6-4-5-7-24(20)25)31(3)26(32)18-27(12-14-30(2)15-13-27)21-8-10-23(29)11-9-21/h4-11,16-17,19H,12-15,18H2,1-3H3/t19-/m0/s1 |
| InChIKey | DRXBWLBZWAJIEF-IBGZPJMESA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-424887 (CHEBI:756878) has role antidepressant (CHEBI:35469) |
| gsk-424887 (CHEBI:756878) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Gsk-424887 | ChEMBL |
| GSK424887 | ChEMBL |