EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H37NO6 |
| Net Charge | 0 |
| Average Mass | 531.649 |
| Monoisotopic Mass | 531.26209 |
| SMILES | COCCOc1cc(Cn2c(C(=O)O)c(-c3ccc(C(C)(C)C)cc3)c3ccccc32)cc(OCCOC)c1 |
| InChI | InChI=1S/C32H37NO6/c1-32(2,3)24-12-10-23(11-13-24)29-27-8-6-7-9-28(27)33(30(29)31(34)35)21-22-18-25(38-16-14-36-4)20-26(19-22)39-17-15-37-5/h6-13,18-20H,14-17,21H2,1-5H3,(H,34,35) |
| InChIKey | OIDYMQICWGYEDR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-376501 (CHEBI:756877) has role hypoglycemic agent (CHEBI:35526) |
| gsk-376501 (CHEBI:756877) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| Gsk-376501 | ChEMBL |
| GSK376501 | ChEMBL |
| GSK-376501A | ChEMBL |
| GSK376501A | ChEMBL |