EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N7O2S |
| Net Charge | 0 |
| Average Mass | 439.545 |
| Monoisotopic Mass | 439.17904 |
| SMILES | CCn1ncc2c(NC3CCOCC3)c(-c3nnc(Cc4sc(C)nc4C)o3)cnc21 |
| InChI | InChI=1S/C21H25N7O2S/c1-4-28-20-15(11-23-28)19(25-14-5-7-29-8-6-14)16(10-22-20)21-27-26-18(30-21)9-17-12(2)24-13(3)31-17/h10-11,14H,4-9H2,1-3H3,(H,22,25) |
| InChIKey | AWDJJMXJUOHGLC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gsk-356278 (CHEBI:756875) has role antidepressant (CHEBI:35469) |
| gsk-356278 (CHEBI:756875) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| Gsk-356278 | ChEMBL |
| GSK356278 | ChEMBL |
| GSK356278B | ChEMBL |
| Citations |
|---|