EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H19NO4 |
| Net Charge | 0 |
| Average Mass | 241.287 |
| Monoisotopic Mass | 241.13141 |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H19NO4/c1-4-12(2,3)9(14)10(15)13-7-5-6-8(13)11(16)17/h8H,4-7H2,1-3H3,(H,16,17)/t8-/m0/s1 |
| InChIKey | FOPALECPEUVCTL-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antiparkinson drug A drug used in the treatment of Parkinson's disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gpi-1485 (CHEBI:756873) has role antiparkinson drug (CHEBI:48407) |
| gpi-1485 (CHEBI:756873) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Gpi-1485 | ChEMBL |
| GPI 1485 | ChEMBL |