EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756870 - fluorofuranylnorprogesterone f-18
| Formula | C25H29O5 |
| Net Charge | 0 |
| Average Mass | 427.503 |
| Monoisotopic Mass | 427.20244 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3([H])[C@@]1([H])CC[C@@]1(C)[C@@]2([H])C[C@H]2O[C@@H](c3ccco3)O[C@]21C(=O)C[18F] |
| InChI | InChI=1S/C25H29FO5/c1-24-9-8-17-16-7-5-15(27)11-14(16)4-6-18(17)19(24)12-22-25(24,21(28)13-26)31-23(30-22)20-3-2-10-29-20/h2-3,10-11,16-19,22-23H,4-9,12-13H2,1H3/t16-,17+,18+,19-,22+,23+,24-,25+/m0/s1/i26-1 |
| InChIKey | VJKRBRUNEOHPBS-JQKUZGBFSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorofuranylnorprogesterone f-18 (CHEBI:756870) has role antineoplastic agent (CHEBI:35610) |
| fluorofuranylnorprogesterone f-18 (CHEBI:756870) is a corticosteroid hormone (CHEBI:36699) |
| Synonyms | Source |
|---|---|
| (18f)ffnp | ChEMBL |
| 18f-ffnp | ChEMBL |
| F18-ffnp | ChEMBL |
| Ffnp f-18 | ChEMBL |
| Fluorofuranylnorprogesterone f-18 | ChEMBL |