EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19Br2N3O2S |
| Net Charge | 0 |
| Average Mass | 513.255 |
| Monoisotopic Mass | 510.95647 |
| SMILES | O=c1cc(NCCCN[C@@H]2CCOc3c(Br)cc(Br)cc32)nc2ccsc12 |
| InChI | InChI=1S/C19H19Br2N3O2S/c20-11-8-12-14(2-6-26-18(12)13(21)9-11)22-4-1-5-23-17-10-16(25)19-15(24-17)3-7-27-19/h3,7-10,14,22H,1-2,4-6H2,(H2,23,24,25)/t14-/m1/s1 |
| InChIKey | NNTYBKTXMKBRFA-CQSZACIVSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crs-3123 (CHEBI:756862) has role antibacterial agent (CHEBI:33282) |
| crs-3123 (CHEBI:756862) has role antiinfective agent (CHEBI:35441) |
| crs-3123 (CHEBI:756862) is a 1-benzopyran (CHEBI:38443) |
| Synonyms | Source |
|---|---|
| Crs-3123 | ChEMBL |
| CRS3123 | ChEMBL |
| REP-3123 | ChEMBL |
| REP3123 | ChEMBL |
| Citations |
|---|