EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O2 |
| Net Charge | 0 |
| Average Mass | 234.299 |
| Monoisotopic Mass | 234.13683 |
| SMILES | CC(=O)Nc1ccc(C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H18N2O2/c1-9(16)14-11-7-5-10(6-8-11)12(17)15-13(2,3)4/h5-8H,1-4H3,(H,14,16)(H,15,17) |
| InChIKey | DJKNRCWSXSZACF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cp1-1189 (CHEBI:756861) has role anti-HIV agent (CHEBI:64946) |
| cp1-1189 (CHEBI:756861) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| Cp1-1189 | ChEMBL |
| CPI-1189 | ChEMBL |