EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N2O11P2 |
| Net Charge | 0 |
| Average Mass | 514.405 |
| Monoisotopic Mass | 514.14813 |
| SMILES | CCCCOP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)nc2=O)C[C@@H]1OP(=O)(O)OCCCC |
| InChI | InChI=1S/C18H32N2O11P2/c1-4-6-8-27-32(23,24)29-12-15-14(31-33(25,26)28-9-7-5-2)10-16(30-15)20-11-13(3)17(21)19-18(20)22/h11,14-16H,4-10,12H2,1-3H3,(H,23,24)(H,25,26)(H,19,21,22)/t14-,15+,16+/m0/s1 |
| InChIKey | ZXQBUNYVGNOEBQ-ARFHVFGLSA-N |
| Roles Classification |
|---|
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nu-3 (CHEBI:756853) has role antiinfective agent (CHEBI:35441) |
| nu-3 (CHEBI:756853) is a nucleoside phosphate (CHEBI:25608) |
| Synonyms | Source |
|---|---|
| Bisphosphocin (nu-3) | ChEMBL |
| Bisphosphocin nu-3 | ChEMBL |
| Bisphosphocin nu3 | ChEMBL |
| Nu-3 | ChEMBL |