EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21ClN5O5P |
| Net Charge | 0 |
| Average Mass | 465.834 |
| Monoisotopic Mass | 465.09688 |
| SMILES | COc1c(C)cnc(Cn2cc(C#CCCOP(=O)(O)O)c3c(Cl)nc(N)nc32)c1C |
| InChI | InChI=1S/C19H21ClN5O5P/c1-11-8-22-14(12(2)16(11)29-3)10-25-9-13(6-4-5-7-30-31(26,27)28)15-17(20)23-19(21)24-18(15)25/h8-9H,5,7,10H2,1-3H3,(H2,21,23,24)(H2,26,27,28) |
| InChIKey | BMZGPNGECPQAGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biib-028 (CHEBI:756852) has role antineoplastic agent (CHEBI:35610) |
| biib-028 (CHEBI:756852) is a pyrrolopyrimidine (CHEBI:38670) |
| Synonyms | Source |
|---|---|
| Biib-028 | ChEMBL |
| BIIB028 | ChEMBL |