EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H35F3N4O5S |
| Net Charge | 0 |
| Average Mass | 644.716 |
| Monoisotopic Mass | 644.22803 |
| SMILES | CCCS(=O)(=O)N1CCN(Cc2ccc(NC(=O)c3ccc(-c4cc(NC(=O)C5CC5)ccc4OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C32H35F3N4O5S/c1-2-19-45(42,43)39-17-15-38(16-18-39)21-22-3-11-26(12-4-22)36-30(40)24-7-5-23(6-8-24)28-20-27(37-31(41)25-9-10-25)13-14-29(28)44-32(33,34)35/h3-8,11-14,20,25H,2,9-10,15-19,21H2,1H3,(H,36,40)(H,37,41) |
| InChIKey | MAQDQJWCSSCURR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-7295 (CHEBI:756846) has role antiviral agent (CHEBI:22587) |
| azd-7295 (CHEBI:756846) is a benzamides (CHEBI:22702) |
| Synonyms | Source |
|---|---|
| Azd 7295 | ChEMBL |
| Azd-7295 | ChEMBL |
| AZD7295 | ChEMBL |