EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N2O4 |
| Net Charge | 0 |
| Average Mass | 186.167 |
| Monoisotopic Mass | 186.06406 |
| SMILES | C[C@@H]1NC(=O)[C@H](CC(=O)O)NC1=O |
| InChI | InChI=1S/C7H10N2O4/c1-3-6(12)9-4(2-5(10)11)7(13)8-3/h3-4H,2H2,1H3,(H,8,13)(H,9,12)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | RVLCUCVJZVRNDC-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspartyl-alanyl-diketopiperazine (CHEBI:756843) has role anti-inflammatory agent (CHEBI:67079) |
| aspartyl-alanyl-diketopiperazine (CHEBI:756843) has role antiviral agent (CHEBI:22587) |
| aspartyl-alanyl-diketopiperazine (CHEBI:756843) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| Ampion | ChEMBL |
| Aspartyl-alanyl-diketopiperazine | ChEMBL |
| Da-dkp | ChEMBL |
| Dmi 9523 | ChEMBL |
| DMI-9523 | ChEMBL |
| DMI9523 | ChEMBL |