EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10ClF3N2O |
| Net Charge | 0 |
| Average Mass | 338.716 |
| Monoisotopic Mass | 338.04338 |
| SMILES | FC(F)(F)Oc1ccc(Nc2ccc3cccc(Cl)c3n2)cc1 |
| InChI | InChI=1S/C16H10ClF3N2O/c17-13-3-1-2-10-4-9-14(22-15(10)13)21-11-5-7-12(8-6-11)23-16(18,19)20/h1-9H,(H,21,22) |
| InChIKey | OZOGDCZJYVSUBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| obefazimod (CHEBI:756838) has role anti-HIV agent (CHEBI:64946) |
| obefazimod (CHEBI:756838) has role anti-inflammatory agent (CHEBI:67079) |
| obefazimod (CHEBI:756838) has role antirheumatic drug (CHEBI:35842) |
| obefazimod (CHEBI:756838) has role antiviral agent (CHEBI:22587) |
| obefazimod (CHEBI:756838) is a organohalogen compound (CHEBI:17792) |
| obefazimod (CHEBI:756838) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| obefazimod | WHO MedNet |
| Synonyms | Source |
|---|---|
| Abx 464 | ChEMBL |
| ABX-464 | ChEMBL |
| ABX464 | ChEMBL |
| SPL-464 | ChEMBL |
| Citations |
|---|