EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N2O5 |
| Net Charge | 0 |
| Average Mass | 259.224 |
| Monoisotopic Mass | 259.08338 |
| SMILES | Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2[18F])c(=O)nc1=O |
| InChI | InChI=1S/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7-,9-/m1/s1/i11-1 |
| InChIKey | GBBJCSTXCAQSSJ-MSYRQUNGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methyl-2'-fluoroarauracil f-18 (CHEBI:756833) has role antineoplastic agent (CHEBI:35610) |
| 5-methyl-2'-fluoroarauracil f-18 (CHEBI:756833) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonyms | Source |
|---|---|
| 18f-fmau | ChEMBL |
| 5-methyl-2'-fluoroarauracil f-18 | ChEMBL |
| D-fmau f-18 | ChEMBL |
| Fmau f-18 | ChEMBL |
| J2.616.188F | ChEMBL |