EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23N4O8 |
| Net Charge | 0 |
| Average Mass | 441.403 |
| Monoisotopic Mass | 441.15253 |
| SMILES | O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)c1ccc([18F])nc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H23FN4O8/c19-13-6-4-10(9-21-13)15(26)20-8-2-1-3-11(16(27)28)22-18(31)23-12(17(29)30)5-7-14(24)25/h4,6,9,11-12H,1-3,5,7-8H2,(H,20,26)(H,24,25)(H,27,28)(H,29,30)(H2,22,23,31)/t11-,12-/m0/s1/i19-1 |
| InChIKey | OLWVRJUNLXQDSP-MVBOSPHXSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. diagnostic imaging agent A substance administered to enhance contrast in images of the inside of the body obtained using X-rays, γ-rays, sound waves, radio waves (MRI), or radioactive particles in order to diagnose disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piflufolastat f18 (CHEBI:756830) has role antineoplastic agent (CHEBI:35610) |
| piflufolastat f18 (CHEBI:756830) has role diagnostic imaging agent (CHEBI:37334) |
| piflufolastat f18 (CHEBI:756830) is a glutamic acid derivative (CHEBI:24315) |
| Synonyms | Source |
|---|---|
| (18f)dcfpyl | ChEMBL |
| 18f-dcfpyl | ChEMBL |
| Dcfpyl f-18 | ChEMBL |
| Piflufolastat (18f) | ChEMBL |
| Piflufolastat f-18 | ChEMBL |
| Piflufolastat f18 | ChEMBL |
| Brand Names | Source |
|---|---|
| Pylarify | ChEMBL |
| Pylclari | ChEMBL |