EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H24N4O2 |
| Net Charge | 0 |
| Average Mass | 424.504 |
| Monoisotopic Mass | 424.18993 |
| SMILES | C[C@]1(O)C[C@@](N)(c2ccc(-c3nc4n(c3-c3ccccc3)COc3ccncc3-4)cc2)C1 |
| InChI | InChI=1S/C26H24N4O2/c1-25(31)14-26(27,15-25)19-9-7-17(8-10-19)22-23(18-5-3-2-4-6-18)30-16-32-21-11-12-28-13-20(21)24(30)29-22/h2-13,31H,14-16,27H2,1H3/t25-,26- |
| InChIKey | AIFGVDXMHWGOGJ-DIVCQZSQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pifusertib (CHEBI:756826) has role antineoplastic agent (CHEBI:35610) |
| pifusertib (CHEBI:756826) is a imidazoles (CHEBI:24780) |
| INN | Source |
|---|---|
| pifusertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Tas-117 | ChEMBL |
| TAS 117 | ChEMBL |
| Citations |
|---|