EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H25F3N2O4 |
| Net Charge | 0 |
| Average Mass | 546.545 |
| Monoisotopic Mass | 546.17664 |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(c2)CCN(C(=O)Oc2ccccc2)C3)c1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H25F3N2O4/c1-39-27-9-5-8-26(28(27)20-10-13-23(14-11-20)31(32,33)34)29(37)35-24-15-12-22-19-36(17-16-21(22)18-24)30(38)40-25-6-3-2-4-7-25/h2-15,18H,16-17,19H2,1H3,(H,35,37) |
| InChIKey | AZUIUVJESCFSLJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | anticholesteremic drug A substance used to lower plasma cholesterol levels. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| slx-4090 (CHEBI:756823) has role anticholesteremic drug (CHEBI:35821) |
| slx-4090 (CHEBI:756823) has role hypoglycemic agent (CHEBI:35526) |
| slx-4090 (CHEBI:756823) is a isoquinolines (CHEBI:24922) |
| Synonyms | Source |
|---|---|
| KD-026 | ChEMBL |
| Slx-4090 | ChEMBL |