EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C34H38N4O6 |
| Net Charge | 0 |
| Average Mass | 635.161 |
| Monoisotopic Mass | 634.25581 |
| SMILES | C=CCc1c(OC(=O)N2CCC(N3CCCCC3)CC2)ccc2nc3c(cc12)Cn1c-3cc2c(c1=O)COC(=O)[C@]2(O)CC.Cl |
| InChI | InChI=1S/C34H38N4O6.ClH/c1-3-8-23-24-17-21-19-38-28(18-26-25(31(38)39)20-43-32(40)34(26,42)4-2)30(21)35-27(24)9-10-29(23)44-33(41)37-15-11-22(12-16-37)36-13-6-5-7-14-36;/h3,9-10,17-18,22,42H,1,4-8,11-16,19-20H2,2H3;1H/t34-;/m0./s1 |
| InChIKey | UWNITDCAZZJJFF-GXUZKUJRSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simmitecan (CHEBI:756822) has role antineoplastic agent (CHEBI:35610) |
| simmitecan (CHEBI:756822) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonyms | Source |
|---|---|
| Simmitecan | ChEMBL |
| Simmitecan hydrochloride | ChEMBL |