EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20ClFN2O2 |
| Net Charge | 0 |
| Average Mass | 398.865 |
| Monoisotopic Mass | 398.11973 |
| SMILES | COc1cc(Cl)ccc1[C@H]1c2nc3cccc(F)c3c2C2(CC2)CN1C(C)=O |
| InChI | InChI=1S/C22H20ClFN2O2/c1-12(27)26-11-22(8-9-22)19-18-15(24)4-3-5-16(18)25-20(19)21(26)14-7-6-13(23)10-17(14)28-2/h3-7,10,21,25H,8-9,11H2,1-2H3/t21-/m0/s1 |
| InChIKey | ZBQMTQGDBFZUBG-NRFANRHFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ono-2952 (CHEBI:756809) has role antispasmodic drug (CHEBI:53784) |
| ono-2952 (CHEBI:756809) is a harmala alkaloid (CHEBI:61379) |
| Synonym | Source |
|---|---|
| Ono-2952 | ChEMBL |