EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H3O4P.C22H30N4O |
| Net Charge | 0 |
| Average Mass | 464.503 |
| Monoisotopic Mass | 464.21886 |
| SMILES | CC(C)CCNc1ncccc1C(=O)N1CCN(Cc2ccccc2)CC1.O=P(O)(O)O |
| InChI | InChI=1S/C22H30N4O.H3O4P/c1-18(2)10-12-24-21-20(9-6-11-23-21)22(27)26-15-13-25(14-16-26)17-19-7-4-3-5-8-19;1-5(2,3)4/h3-9,11,18H,10,12-17H2,1-2H3,(H,23,24);(H3,1,2,3,4) |
| InChIKey | LWHMGALTTIYPJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nsi-189 phosphate (CHEBI:756808) has role antidepressant (CHEBI:35469) |
| nsi-189 phosphate (CHEBI:756808) is a aromatic carboxylic acid (CHEBI:33859) |
| nsi-189 phosphate (CHEBI:756808) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonym | Source |
|---|---|
| Nsi-189 phosphate | ChEMBL |