EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20N6O |
| Net Charge | 0 |
| Average Mass | 264.333 |
| Monoisotopic Mass | 264.16986 |
| SMILES | Nc1ncnc2c1ncn2CCNCCCCCO |
| InChI | InChI=1S/C12H20N6O/c13-11-10-12(16-8-15-11)18(9-17-10)6-5-14-4-2-1-3-7-19/h8-9,14,19H,1-7H2,(H2,13,15,16) |
| InChIKey | CVPTTZZCRDVGSU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HSV agent An antiviral agent that destroys or inhibits the replication of the herpes simplex virus (also known as the human herpes virus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nb-001 (CHEBI:756805) has role anti-HSV agent (CHEBI:64952) |
| nb-001 (CHEBI:756805) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| HTS-09836 | ChEMBL |
| Nb-001 | ChEMBL |
| NB001 | ChEMBL |
| Citations |
|---|