EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H56N6O9S |
| Net Charge | 0 |
| Average Mass | 821.010 |
| Monoisotopic Mass | 820.38295 |
| SMILES | [H][C@]12CN3C(=O)[C@]([H])(CCCCC/C=C/[C@@H]4C[C@@]4(C(=O)NS(=O)(=O)C4(C)CC4)NC(=O)[C@]3([H])C1)NC(=O)O[C@]1([H])CCC[C@@]1([H])CCCCCc1nc3ccc(OC)cc3nc1O2 |
| InChI | InChI=1S/C42H56N6O9S/c1-41(20-21-41)58(53,54)47-39(51)42-24-27(42)14-8-4-3-5-9-16-32-38(50)48-25-29(23-34(48)36(49)46-42)56-37-31(43-30-19-18-28(55-2)22-33(30)44-37)15-10-6-7-12-26-13-11-17-35(26)57-40(52)45-32/h8,14,18-19,22,26-27,29,32,34-35H,3-7,9-13,15-17,20-21,23-25H2,1-2H3,(H,45,52)(H,46,49)(H,47,51)/b14-8+/t26-,27-,29-,32+,34+,35-,42-/m1/s1 |
| InChIKey | BLFKRFGLQFYXDF-WAZRELCSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-6325 (CHEBI:756804) has role antiviral agent (CHEBI:22587) |
| mk-6325 (CHEBI:756804) is a cyclic peptide (CHEBI:23449) |
| Synonyms | Source |
|---|---|
| Mk-6325 | ChEMBL |
| MK 6325 | ChEMBL |