EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756800 - lb-100
| Formula | C13H20N2O4 |
| Net Charge | 0 |
| Average Mass | 268.313 |
| Monoisotopic Mass | 268.14231 |
| SMILES | CN1CCN(C(=O)C2C(C(=O)O)[C@H]3CC[C@@H]2O3)CC1 |
| InChI | InChI=1S/C13H20N2O4/c1-14-4-6-15(7-5-14)12(16)10-8-2-3-9(19-8)11(10)13(17)18/h8-11H,2-7H2,1H3,(H,17,18)/t8-,9+,10?,11?/m0/s1 |
| InChIKey | JUQMLSGOTNKJKI-IZUQBHJASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lb-100 (CHEBI:756800) has role antineoplastic agent (CHEBI:35610) |
| lb-100 (CHEBI:756800) is a N-methylpiperazine (CHEBI:46920) |
| Synonyms | Source |
|---|---|
| Lb-100 | ChEMBL |
| LB 100 | ChEMBL |
| Citations |
|---|