EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H24FN3O2 |
| Net Charge | 0 |
| Average Mass | 405.473 |
| Monoisotopic Mass | 405.18526 |
| SMILES | O=C(Cc1ccc(-c2ccc(N3CCOCC3)cc2)cn1)NCc1cccc(F)c1 |
| InChI | InChI=1S/C24H24FN3O2/c25-21-3-1-2-18(14-21)16-27-24(29)15-22-7-4-20(17-26-22)19-5-8-23(9-6-19)28-10-12-30-13-11-28/h1-9,14,17H,10-13,15-16H2,(H,27,29) |
| InChIKey | CMKKPJNMYLOUCE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kx2-361 (CHEBI:756799) has role antineoplastic agent (CHEBI:35610) |
| kx2-361 (CHEBI:756799) is a morpholines (CHEBI:38785) |
| Synonyms | Source |
|---|---|
| KX-02 | ChEMBL |
| Kx2-361 | ChEMBL |
| KX-2361 | ChEMBL |
| Citations |
|---|