EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H39NO5S |
| Net Charge | 0 |
| Average Mass | 489.678 |
| Monoisotopic Mass | 489.25489 |
| SMILES | C/C1=C/C[C@@H](/C(C)=C/c2csc(C)n2)OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)/C=C/C1 |
| InChI | InChI=1S/C27H39NO5S/c1-16-9-8-10-17(2)25(31)19(4)26(32)27(6,7)23(29)14-24(30)33-22(12-11-16)18(3)13-21-15-34-20(5)28-21/h8,10-11,13,15,17,19,22-23,25,29,31H,9,12,14H2,1-7H3/b10-8+,16-11-,18-13+/t17-,19+,22-,23-,25-/m0/s1 |
| InChIKey | XAYAKDZVINDZGB-BMVMHAJPSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kos-1584 (CHEBI:756796) has role antineoplastic agent (CHEBI:35610) |
| kos-1584 (CHEBI:756796) is a thiazoles (CHEBI:48901) |
| Synonyms | Source |
|---|---|
| 9,10-trans-dehydroepothilone d | ChEMBL |
| Dehydelone | ChEMBL |
| (e)-9,10-dehydroepothilone d | ChEMBL |
| (e)-9,10-didehydroepothilone d | ChEMBL |
| Kos-1584 | ChEMBL |
| R-1645 | ChEMBL |