EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H23F7N6O4S2 |
| Net Charge | 0 |
| Average Mass | 704.650 |
| Monoisotopic Mass | 704.11104 |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)c(F)c1)[C@H]1CN(c2nc3nc(C4CC4)ncc3s2)CCN1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C28H23F7N6O4S2/c29-19-11-15(1-8-21(19)45-28(33,34)35)12-37-25(42)20-14-40(26-39-24-22(46-26)13-36-23(38-24)16-2-3-16)9-10-41(20)47(43,44)18-6-4-17(5-7-18)27(30,31)32/h1,4-8,11,13,16,20H,2-3,9-10,12,14H2,(H,37,42)/t20-/m1/s1 |
| InChIKey | JQLOVYLALGSISI-HXUWFJFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jtk-853 (CHEBI:756795) has role antiinfective agent (CHEBI:35441) |
| jtk-853 (CHEBI:756795) is a N-arylpiperazine (CHEBI:46848) |
| Synonym | Source |
|---|---|
| Jtk-853 | ChEMBL |