EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O7.C20H20ClN3 |
| Net Charge | 0 |
| Average Mass | 529.977 |
| Monoisotopic Mass | 529.16158 |
| SMILES | Clc1ccc(-c2nn(Cc3ccccc3)c3c2CCNCC3)cc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H20ClN3.C6H8O7/c21-17-8-6-16(7-9-17)20-18-10-12-22-13-11-19(18)24(23-20)14-15-4-2-1-3-5-15;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-9,22H,10-14H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | DIQZMBPDLFAJLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-18038683 (CHEBI:756793) has role antidepressant (CHEBI:35469) |
| jnj-18038683 (CHEBI:756793) has role antipsychotic agent (CHEBI:35476) |
| jnj-18038683 (CHEBI:756793) is a pyrazoles (CHEBI:26410) |
| jnj-18038683 (CHEBI:756793) is a ring assembly (CHEBI:36820) |
| Synonym | Source |
|---|---|
| Jnj-18038683 | ChEMBL |