EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34FN7O2 |
| Net Charge | 0 |
| Average Mass | 519.625 |
| Monoisotopic Mass | 519.27580 |
| SMILES | CN1CCN(C(=O)[C@H](CCCN[C@@H]2C[C@H]2c2ccc(F)cc2)NC(=O)c2ccc(-n3ccnn3)cc2)CC1 |
| InChI | InChI=1S/C28H34FN7O2/c1-34-15-17-35(18-16-34)28(38)25(3-2-12-30-26-19-24(26)20-4-8-22(29)9-5-20)32-27(37)21-6-10-23(11-7-21)36-14-13-31-33-36/h4-11,13-14,24-26,30H,2-3,12,15-19H2,1H3,(H,32,37)/t24-,25-,26+/m0/s1 |
| InChIKey | KQKBMHGOHXOHTD-KKUQBAQOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antifibrotic agent Any agent which acts to reduce fibrosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bomedemstat (CHEBI:756789) has role antifibrotic agent (CHEBI:233423) |
| bomedemstat (CHEBI:756789) has role antineoplastic agent (CHEBI:35610) |
| bomedemstat (CHEBI:756789) is a N-acylglycine (CHEBI:16180) |
| INN | Source |
|---|---|
| bomedemstat | WHO MedNet |
| Synonym | Source |
|---|---|
| IMG-7289 | ChEMBL |
| Citations |
|---|