EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:756788 - hydronidone
| Formula | C12H11NO2 |
| Net Charge | 0 |
| Average Mass | 201.225 |
| Monoisotopic Mass | 201.07898 |
| SMILES | Cc1ccc(=O)n(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C12H11NO2/c1-9-2-7-12(15)13(8-9)10-3-5-11(14)6-4-10/h2-8,14H,1H3 |
| InChIKey | NETTXQJYJRFTFS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydronidone (CHEBI:756788) has role anti-HBV agent (CHEBI:64951) |
| hydronidone (CHEBI:756788) has role hepatoprotective agent (CHEBI:62868) |
| hydronidone (CHEBI:756788) is a pyridone (CHEBI:38183) |
| Synonyms | Source |
|---|---|
| F 351 | ChEMBL |
| F-351 | ChEMBL |
| Hydronidone | ChEMBL |