EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H36N6O4S |
| Net Charge | 0 |
| Average Mass | 564.712 |
| Monoisotopic Mass | 564.25187 |
| SMILES | CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)Nc1sc(-c2ncco2)nc1-c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C29H36N6O4S/c1-18(30-2)24(36)32-23(20-12-7-4-8-13-20)29(38)35-16-9-14-21(35)25(37)34-27-22(19-10-5-3-6-11-19)33-28(40-27)26-31-15-17-39-26/h3,5-6,10-11,15,17-18,20-21,23,30H,4,7-9,12-14,16H2,1-2H3,(H,32,36)(H,34,37)/t18-,21-,23-/m0/s1 |
| InChIKey | HSHPBORBOJIXSQ-HARLFGEKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gdc-0917 (CHEBI:756782) has role antineoplastic agent (CHEBI:35610) |
| gdc-0917 (CHEBI:756782) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| Cudc 427 | ChEMBL |
| CUDC-427 | ChEMBL |
| Gdc-0917 | ChEMBL |
| Citations |
|---|