EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34N10O11S |
| Net Charge | 0 |
| Average Mass | 730.717 |
| Monoisotopic Mass | 730.21292 |
| SMILES | N[C@@H](CNC(=O)CC[C@@H](NC(=O)c1ccc(NCc2cnc3ncnc(=O)c-3n2)cc1)C(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C29H34N10O11S/c30-16(25(44)38-18(7-21(41)42)26(45)39-19(11-51)29(49)50)10-32-20(40)6-5-17(28(47)48)37-24(43)13-1-3-14(4-2-13)31-8-15-9-33-23-22(36-15)27(46)35-12-34-23/h1-4,9,12,16-19,31,51H,5-8,10-11,30H2,(H,32,40)(H,37,43)(H,38,44)(H,39,45)(H,41,42)(H,47,48)(H,49,50)(H,33,34,35,46)/t16-,17+,18-,19-/m0/s1 |
| InChIKey | YZSIZVRFVQKMJU-RDGPPVDQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etarfolatide (CHEBI:756781) has role antineoplastic agent (CHEBI:35610) |
| etarfolatide (CHEBI:756781) is a polypeptide (CHEBI:15841) |
| Synonyms | Source |
|---|---|
| EC-20 | ChEMBL |
| Etarfolatide | ChEMBL |