EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H36N10O10S |
| Net Charge | 0 |
| Average Mass | 872.877 |
| Monoisotopic Mass | 872.23366 |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(CCNC(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21)C(=O)c1ccc(NCc2cnc3nc(N)nc(=O)c3n2)cc1 |
| InChI | InChI=1S/C42H36N10O10S/c43-33(55)12-11-30(38(58)59)52(37(57)20-1-3-21(4-2-20)46-18-23-19-47-35-34(48-23)36(56)51-40(44)50-35)14-13-45-41(63)49-22-5-8-27-26(15-22)39(60)62-42(27)28-9-6-24(53)16-31(28)61-32-17-25(54)7-10-29(32)42/h1-10,15-17,19,30,46,53-54H,11-14,18H2,(H2,43,55)(H,58,59)(H2,45,49,63)(H3,44,47,50,51,56)/t30-/m0/s1 |
| InChIKey | ZMTAPBHUSYTHBY-PMERELPUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ec-17 (CHEBI:756780) has role antineoplastic agent (CHEBI:35610) |
| ec-17 (CHEBI:756780) is a glutamine derivative (CHEBI:70813) |
| Synonyms | Source |
|---|---|
| Ec 17 | ChEMBL |
| Ec-17 | ChEMBL |
| Ec17 (folate-fitc) | ChEMBL |
| Folate-fitc | ChEMBL |
| Folate-fluorescein conjugate | ChEMBL |