EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H66N2O9 |
| Net Charge | 0 |
| Average Mass | 718.973 |
| Monoisotopic Mass | 718.47683 |
| SMILES | [H][C@]1([C@H](C)[C@@H](O)CC)O[C@@H]1C[C@@](C)(O)/C=C/C=C(\C)[C@@]1([H])OC(=O)C[C@H](O)CC[C@@](C)(O)[C@@H](OC(=O)N2CCN(C3CCCCCC3)CC2)/C=C/[C@@H]1C |
| InChI | InChI=1S/C40H66N2O9/c1-7-32(44)29(4)37-33(49-37)26-39(5,47)19-12-13-27(2)36-28(3)16-17-34(40(6,48)20-18-31(43)25-35(45)51-36)50-38(46)42-23-21-41(22-24-42)30-14-10-8-9-11-15-30/h12-13,16-17,19,28-34,36-37,43-44,47-48H,7-11,14-15,18,20-26H2,1-6H3/b17-16+,19-12+,27-13+/t28-,29+,31+,32-,33+,34-,36+,37+,39-,40+/m0/s1 |
| InChIKey | MNOMBFWMICHMKG-MGYWSNOQSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| e7107 (CHEBI:756779) has role antineoplastic agent (CHEBI:35610) |
| e7107 (CHEBI:756779) is a diterpene lactone (CHEBI:49193) |
| Synonym | Source |
|---|---|
| E7107 | ChEMBL |