EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H14NO.C8H6ClN2O2S |
| Net Charge | 0 |
| Average Mass | 333.841 |
| Monoisotopic Mass | 333.09139 |
| SMILES | CC1=Nc2ccc(Cl)cc2S(=O)(=O)[N-]1.C[N+](C)(C)CCO |
| InChI | InChI=1S/C8H6ClN2O2S.C5H14NO/c1-5-10-7-3-2-6(9)4-8(7)14(12,13)11-5;1-6(2,3)4-5-7/h2-4H,1H3;7H,4-5H2,1-3H3/q-1;+1 |
| InChIKey | YLLWQNAEYILHLV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diazoxide choline (CHEBI:756777) has role anti-obesity agent (CHEBI:74518) |
| diazoxide choline (CHEBI:756777) has role antineoplastic agent (CHEBI:35610) |
| diazoxide choline (CHEBI:756777) is a benzothiadiazine (CHEBI:50265) |
| Synonym | Source |
|---|---|
| Diazoxide choline | ChEMBL |