EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12ClN3O4 |
| Net Charge | 0 |
| Average Mass | 261.665 |
| Monoisotopic Mass | 261.05163 |
| SMILES | Nc1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1Cl |
| InChI | InChI=1S/C9H12ClN3O4/c10-4-2-13(9(16)12-8(4)11)7-1-5(15)6(3-14)17-7/h2,5-7,14-15H,1,3H2,(H2,11,12,16)/t5-,6+,7+/m0/s1 |
| InChIKey | NGGRGTWYSXYVDK-RRKCRQDMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cytochlor (CHEBI:756776) has role antineoplastic agent (CHEBI:35610) |
| cytochlor (CHEBI:756776) is a pyrimidine nucleoside (CHEBI:26440) |
| Synonyms | Source |
|---|---|
| 5-cldc | ChEMBL |
| Cytochlor | ChEMBL |
| NSC-371331 | ChEMBL |