EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H55NO14S |
| Net Charge | 0 |
| Average Mass | 914.039 |
| Monoisotopic Mass | 913.33433 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]3(O)C[C@H](OC(=O)[C@H](O)[C@@H](NC(=O)c4ccccc4)c4ccccc4)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]1(C)[C@@H](OCSC)C[C@H]1OC[C@]12OC(C)=O)C3(C)C |
| InChI | InChI=1S/C49H55NO14S/c1-27-33(62-45(57)38(53)37(30-17-11-8-12-18-30)50-43(55)31-19-13-9-14-20-31)24-49(58)42(63-44(56)32-21-15-10-16-22-32)40-47(6,41(54)39(61-28(2)51)36(27)46(49,4)5)34(60-26-65-7)23-35-48(40,25-59-35)64-29(3)52/h8-22,33-35,37-40,42,53,58H,23-26H2,1-7H3,(H,50,55)/t33-,34-,35+,37-,38+,39+,40-,42-,47+,48-,49+/m0/s1 |
| InChIKey | UBJAHGAUPNGZFF-XOVTVWCYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bms-184476 (CHEBI:756771) has role antineoplastic agent (CHEBI:35610) |
| bms-184476 (CHEBI:756771) is a taxane diterpenoid (CHEBI:50367) |
| Synonyms | Source |
|---|---|
| 7-methylthiomethylpaclitaxel | ChEMBL |
| 7-((methylthio)methyl)paclitaxel | ChEMBL |
| Bms-184476 | ChEMBL |