EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:756764 - alt-2074
| Formula | C10H13NSe |
| Net Charge | 0 |
| Average Mass | 226.181 |
| Monoisotopic Mass | 227.02132 |
| SMILES | CC1(C)CN[Se]c2ccccc21 |
| InChI | InChI=1S/C10H13NSe/c1-10(2)7-11-12-9-6-4-3-5-8(9)10/h3-6,11H,7H2,1-2H3 |
| InChIKey | FXRYWOJYVGJZLE-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alt-2074 (CHEBI:756764) is a benzenoid aromatic compound (CHEBI:33836) |
| Synonyms | Source |
|---|---|
| Alt-2074 | ChEMBL |
| BXT-51072 | ChEMBL |
| SYI 2074 | ChEMBL |
| SYI-2074 | ChEMBL |