EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H48Cl5NO4 |
| Net Charge | 0 |
| Average Mass | 724.037 |
| Monoisotopic Mass | 721.20260 |
| SMILES | [H][C@@]12CC=C3C[C@@H](OC(=O)Oc4c(Cl)c(OC)nc(C(Cl)(Cl)Cl)c4Cl)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)C |
| InChI | InChI=1S/C35H48Cl5NO4/c1-19(2)8-7-9-20(3)24-12-13-25-23-11-10-21-18-22(14-16-33(21,4)26(23)15-17-34(24,25)5)44-32(42)45-29-27(36)30(35(38,39)40)41-31(43-6)28(29)37/h10,19-20,22-26H,7-9,11-18H2,1-6H3/t20-,22+,23+,24-,25+,26+,33+,34-/m1/s1 |
| InChIKey | ZJUUIXYKTPSIOH-LEZJFEBPSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-demethyl-4-cholesteryloxycarbonylpenclomedine (CHEBI:756758) has role antineoplastic agent (CHEBI:35610) |
| 4-demethyl-4-cholesteryloxycarbonylpenclomedine (CHEBI:756758) is a cholestanoid (CHEBI:50401) |
| INN | Source |
|---|---|
| mipicoledine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-demethyl-4-cholesteryloxycarbonylpenclomedine | ChEMBL |
| Dm-choc-pen | ChEMBL |