EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19F2N3O4S |
| Net Charge | 0 |
| Average Mass | 483.496 |
| Monoisotopic Mass | 483.10643 |
| SMILES | [H][C@@]12COCCN1C(=O)c1c(O)c(=O)ccn1N2[C@@H]1c2ccccc2SCc2c1ccc(F)c2F |
| InChI | InChI=1S/C24H19F2N3O4S/c25-16-6-5-13-15(20(16)26)12-34-18-4-2-1-3-14(18)21(13)29-19-11-33-10-9-27(19)24(32)22-23(31)17(30)7-8-28(22)29/h1-8,19,21,31H,9-12H2/t19-,21+/m1/s1 |
| InChIKey | FIDLLEYNNRGVFR-CTNGQTDRSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| baloxavir (CHEBI:756721) has role antiviral agent (CHEBI:22587) |
| baloxavir (CHEBI:756721) is a dibenzothiepine (CHEBI:38924) |
| Synonyms | Source |
|---|---|
| Baloxavir | ChEMBL |
| S-033447 | ChEMBL |
| Citations |
|---|