EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13ClN2O |
| Net Charge | 0 |
| Average Mass | 236.702 |
| Monoisotopic Mass | 236.07164 |
| SMILES | CC(C)(O)c1nc2ccc(Cl)cc2cc1N |
| InChI | InChI=1S/C12H13ClN2O/c1-12(2,16)11-9(14)6-7-5-8(13)3-4-10(7)15-11/h3-6,16H,14H2,1-2H3 |
| InChIKey | GUHFUVLKYSQIOQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reproxalap (CHEBI:756717) has role ophthalmology drug (CHEBI:66981) |
| reproxalap (CHEBI:756717) is a organohalogen compound (CHEBI:17792) |
| reproxalap (CHEBI:756717) is a quinolines (CHEBI:26513) |
| INN | Source |
|---|---|
| reproxalap | WHO MedNet |
| Synonyms | Source |
|---|---|
| ADX-102 | ChEMBL |
| ALD-102 | ChEMBL |
| NS2 | ChEMBL |