EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O2.C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 268.313 |
| Monoisotopic Mass | 268.14231 |
| SMILES | NCCC[C@H](N)C(=O)O.O=C(O)Cc1ccccc1 |
| InChI | InChI=1S/C8H8O2.C5H12N2O2/c9-8(10)6-7-4-2-1-3-5-7;6-3-1-2-4(7)5(8)9/h1-5H,6H2,(H,9,10);4H,1-3,6-7H2,(H,8,9)/t;4-/m.0/s1 |
| InChIKey | LRSYFEZBIMVWRY-VWMHFEHESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornithine phenylacetate (CHEBI:756712) has role hepatoprotective agent (CHEBI:62868) |
| ornithine phenylacetate (CHEBI:756712) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| L-OP | ChEMBL |
| L-ornithine, benzeneacetate (1:1) | ChEMBL |
| OCR-002 | ChEMBL |
| OP | ChEMBL |
| Ornithine phenylacetate | ChEMBL |