EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28N6O3S |
| Net Charge | 0 |
| Average Mass | 480.594 |
| Monoisotopic Mass | 480.19436 |
| SMILES | Cc1cc2cc(Oc3ccnc(Nc4cccc(CS(=O)(=O)NCCN(C)C)c4)n3)ccc2n1 |
| InChI | InChI=1S/C24H28N6O3S/c1-17-13-19-15-21(7-8-22(19)27-17)33-23-9-10-25-24(29-23)28-20-6-4-5-18(14-20)16-34(31,32)26-11-12-30(2)3/h4-10,13-15,26-27H,11-12,16H2,1-3H3,(H,25,28,29) |
| InChIKey | TTZSNFLLYPYKIL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| surufatinib (CHEBI:756707) has role antineoplastic agent (CHEBI:35610) |
| surufatinib (CHEBI:756707) has role renoprotective agent (CHEBI:231911) |
| surufatinib (CHEBI:756707) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| HMPL-012 | ChEMBL |
| Sulfatinib | ChEMBL |
| Surufatinib | ChEMBL |
| Citations |
|---|