EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H29FN4O |
| Net Charge | 0 |
| Average Mass | 468.576 |
| Monoisotopic Mass | 468.23254 |
| SMILES | COCCNCCc1cccc(Nc2ncc3c(n2)-c2ccccc2[C@H](c2ccccc2F)C3)c1 |
| InChI | InChI=1S/C29H29FN4O/c1-35-16-15-31-14-13-20-7-6-8-22(17-20)33-29-32-19-21-18-26(24-10-4-5-12-27(24)30)23-9-2-3-11-25(23)28(21)34-29/h2-12,17,19,26,31H,13-16,18H2,1H3,(H,32,33,34)/t26-/m1/s1 |
| InChIKey | KPJDVVCDVBFRMU-AREMUKBSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| derazantinib (CHEBI:756705) has role antineoplastic agent (CHEBI:35610) |
| derazantinib (CHEBI:756705) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| derazantinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Arq-087 | ChEMBL |
| ARQ 087 | ChEMBL |
| ARQ087 | ChEMBL |
| Citations |
|---|