EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21N7O3 |
| Net Charge | 0 |
| Average Mass | 407.434 |
| Monoisotopic Mass | 407.17059 |
| SMILES | Cc1ccc(-c2nc(N)nc3c2nnn3Cc2cccc(CO[C@H]3CCOC3)n2)o1 |
| InChI | InChI=1S/C20H21N7O3/c1-12-5-6-16(30-12)17-18-19(24-20(21)23-17)27(26-25-18)9-13-3-2-4-14(22-13)10-29-15-7-8-28-11-15/h2-6,15H,7-11H2,1H3,(H2,21,23,24)/t15-/m0/s1 |
| InChIKey | KURQKNMKCGYWRJ-HNNXBMFYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ciforadenant (CHEBI:756704) has role antineoplastic agent (CHEBI:35610) |
| ciforadenant (CHEBI:756704) has role antiparkinson drug (CHEBI:48407) |
| ciforadenant (CHEBI:756704) is a triazolopyrimidines (CHEBI:48435) |
| INN | Source |
|---|---|
| ciforadenant | WHO MedNet |
| Synonyms | Source |
|---|---|
| CPI-444 | ChEMBL |
| V-81444 | ChEMBL |
| V81444 | ChEMBL |
| Citations |
|---|