EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H24N4O6 |
| Net Charge | 0 |
| Average Mass | 536.544 |
| Monoisotopic Mass | 536.16958 |
| SMILES | [H][C@]12C[C@@]3(OC(=O)N(CCOC)C3=O)[C@](C)(O1)n1c3ccccc3c3c4c(c5c6ccccc6n2c5c31)C(=O)NC4 |
| InChI | InChI=1S/C30H24N4O6/c1-29-30(27(36)32(11-12-38-2)28(37)40-30)13-20(39-29)33-18-9-5-3-7-15(18)22-23-17(14-31-26(23)35)21-16-8-4-6-10-19(16)34(29)25(21)24(22)33/h3-10,20H,11-14H2,1-2H3,(H,31,35)/t20-,29+,30+/m1/s1 |
| InChIKey | SHWPFRVVBIKGAT-LYWBODIJSA-N |
| Roles Classification |
|---|
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pegcantratinib (CHEBI:756702) has role antipsoriatic (CHEBI:50748) |
| pegcantratinib (CHEBI:756702) has role dermatologic drug (CHEBI:50177) |
| pegcantratinib (CHEBI:756702) is a indolocarbazole (CHEBI:51915) |
| INN | Source |
|---|---|
| pegcantratinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CT-327 | ChEMBL |
| CT327 | ChEMBL |
| SNA-120 | ChEMBL |