EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N4O3 |
| Net Charge | 0 |
| Average Mass | 406.486 |
| Monoisotopic Mass | 406.20049 |
| SMILES | CO[C@@H](C)Cn1c(=O)n(C)c2cnc3ccc(-c4cncc(C(C)(C)O)c4)cc3c21 |
| InChI | InChI=1S/C23H26N4O3/c1-14(30-5)13-27-21-18-9-15(16-8-17(11-24-10-16)23(2,3)29)6-7-19(18)25-12-20(21)26(4)22(27)28/h6-12,14,29H,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | ACCFLVVUVBJNGT-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| samotolisib (CHEBI:756701) has role antineoplastic agent (CHEBI:35610) |
| samotolisib (CHEBI:756701) is a imidazoquinoline (CHEBI:38776) |
| INN | Source |
|---|---|
| samotolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY 3023414 | ChEMBL |
| LY-3023414 | ChEMBL |
| LY3023414 | ChEMBL |
| Citations |
|---|