EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6O3.C21H23ClFNO2 |
| Net Charge | 0 |
| Average Mass | 465.949 |
| Monoisotopic Mass | 465.17183 |
| SMILES | CC(O)C(=O)O.O=C(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H23ClFNO2.C3H6O3/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16;1-2(4)3(5)6/h3-10,26H,1-2,11-15H2;2,4H,1H3,(H,5,6) |
| InChIKey | BVUSNQJCSYDJJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haloperidol lactate (CHEBI:756697) has role antipsychotic agent (CHEBI:35476) |
| haloperidol lactate (CHEBI:756697) is a aromatic ketone (CHEBI:76224) |
| Brand Name | Source |
|---|---|
| Haloperidol intensol | ChEMBL |