EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Na.C26H25N8O11S2 |
| Net Charge | 0 |
| Average Mass | 712.655 |
| Monoisotopic Mass | 712.09819 |
| SMILES | [H][C@]12SCC(/C=C3\CCN([C@@H]4CCN(C(=O)OCc5oc(=O)oc5C)C4)C3=O)=C(C(=O)[O-])N1C(=O)[C@H]2NC(=O)/C(=N/O)c1nsc(N)n1.[Na+] |
| InChI | InChI=1S/C26H26N8O11S2.Na/c1-10-14(45-26(41)44-10)8-43-25(40)32-4-3-13(7-32)33-5-2-11(20(33)36)6-12-9-46-22-16(21(37)34(22)17(12)23(38)39)28-19(35)15(30-42)18-29-24(27)47-31-18;/h6,13,16,22,42H,2-5,7-9H2,1H3,(H,28,35)(H,38,39)(H2,27,29,31);/q;+1/p-1/b11-6+,30-15+;/t13-,16-,22-;/m1./s1 |
| InChIKey | MFAWUGGPPMTWPU-INRVRKGJSA-M |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ceftobiprole medocaril sodium (CHEBI:756687) has role antibacterial agent (CHEBI:33282) |
| ceftobiprole medocaril sodium (CHEBI:756687) has role antiinfective agent (CHEBI:35441) |
| ceftobiprole medocaril sodium (CHEBI:756687) has role antimicrobial agent (CHEBI:33281) |
| ceftobiprole medocaril sodium (CHEBI:756687) has role antineoplastic agent (CHEBI:35610) |
| ceftobiprole medocaril sodium (CHEBI:756687) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| BAL-5788 | ChEMBL |
| BAL-5788-001 | ChEMBL |
| BAL5788-001 | ChEMBL |
| Ceftobiprole medocaril sodium salt | ChEMBL |
| RO-65-5788 | ChEMBL |
| RO-655788 | ChEMBL |