EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H45N5O4 |
| Net Charge | 0 |
| Average Mass | 563.743 |
| Monoisotopic Mass | 563.34715 |
| SMILES | [H][C@@]12Cc3cnc4cccc(c34)[C@@]1([H])C[C@@H](C(=O)N[C@]1(C(C)C)O[C@]3(O)N(C1=O)[C@@]([H])([C@@H](C)CC)CN1CCC[C@]13[H])CN2C |
| InChI | InChI=1S/C32H45N5O4/c1-6-19(4)26-17-36-12-8-11-27(36)32(40)37(26)30(39)31(41-32,18(2)3)34-29(38)21-13-23-22-9-7-10-24-28(22)20(15-33-24)14-25(23)35(5)16-21/h7,9-10,15,18-19,21,23,25-27,33,40H,6,8,11-14,16-17H2,1-5H3,(H,34,38)/t19-,21+,23+,25+,26+,27-,31+,32-/m0/s1 |
| InChIKey | OPAVODIYXVLOOM-MXBMDEFOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desocriptine (CHEBI:756685) is a ergoline alkaloid (CHEBI:60529) |
| INNs | Source |
|---|---|
| desocriptina | WHO MedNet |
| desocriptine | WHO MedNet |