EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H37N3O13 |
| Net Charge | 0 |
| Average Mass | 635.623 |
| Monoisotopic Mass | 635.23264 |
| SMILES | [H][C@]12C[C@@]3([H])[C@H](N(C)C)C(O)=C(C(=O)NCN[C@@H]4[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]4O)C(=O)[C@@]3(O)C(O)=C1C(=O)c1c(O)cccc1[C@@]2(C)O |
| InChI | InChI=1S/C29H37N3O13/c1-28(43)10-5-4-6-13(34)15(10)21(36)16-11(28)7-12-19(32(2)3)22(37)17(25(40)29(12,44)24(16)39)26(41)31-9-30-18-23(38)20(35)14(8-33)45-27(18)42/h4-6,11-12,14,18-20,23,27,30,33-35,37-39,42-44H,7-9H2,1-3H3,(H,31,41)/t11-,12-,14+,18+,19-,20+,23+,27+,28+,29-/m0/s1 |
| InChIKey | QQFZVDWDMZYSQX-FUUYDGDCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| meglucycline (CHEBI:756679) is a tetracyclines (CHEBI:26895) |
| INNs | Source |
|---|---|
| megluciclina | WHO MedNet |
| meglucycline | WHO MedNet |
| Synonyms | Source |
|---|---|
| MCMC 3588 | ChEMBL |
| MCMC-3588 | ChEMBL |
| Neoprodesciclina | ChEMBL |